About (4,5-dimethyl-1,2,4-triazol-3-yl)methanol
(4,5-dimethyl-1,2,4-triazol-3-yl)methanol (PubChem CID 18726738) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is (4,5-dimethyl-1,2,4-triazol-3-yl)methanol.
Molecular Properties
| Compound Name | (4,5-dimethyl-1,2,4-triazol-3-yl)methanol |
| PubChem CID | 18726738 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | (4,5-dimethyl-1,2,4-triazol-3-yl)methanol |
| SMILES | Cc1nnc(CO)n1C |
| InChI | InChI=1S/C5H9N3O/c1-4-6-7-5(3-9)8(4)2/h9H,3H2,1-2H3 |
| InChIKey | SUYSEWOAGPULMR-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4,5-dimethyl-1,2,4-triazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethyl-1,2,4-triazol-3-yl)methanol?
The IUPAC name of (4,5-dimethyl-1,2,4-triazol-3-yl)methanol (CID 18726738) is (4,5-dimethyl-1,2,4-triazol-3-yl)methanol.
What is the SMILES notation for (4,5-dimethyl-1,2,4-triazol-3-yl)methanol?
The canonical SMILES for (4,5-dimethyl-1,2,4-triazol-3-yl)methanol is Cc1nnc(CO)n1C.
What is the InChIKey of (4,5-dimethyl-1,2,4-triazol-3-yl)methanol?
The InChIKey is SUYSEWOAGPULMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-4-6-7-5(3-9)8(4)2/h9H,3H2,1-2H3.
What are the key properties of (4,5-dimethyl-1,2,4-triazol-3-yl)methanol?
(4,5-dimethyl-1,2,4-triazol-3-yl)methanol has a molecular weight of 127.15 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethyl-1,2,4-triazol-3-yl)methanol is sourced from PubChem (CID 18726738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).