About 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline
5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline (PubChem CID 18726746) has the molecular formula C14H13FN2O2
and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline.
Molecular Properties
| Compound Name | 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline |
| PubChem CID | 18726746 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline |
| SMILES | COc1nc2cc(C)c(C)c(C#CF)c2nc1OC |
| InChI | InChI=1S/C14H13FN2O2/c1-8-7-11-12(10(5-6-15)9(8)2)17-14(19-4)13(16-11)18-3/h7H,1-4H3 |
| InChIKey | BVFNNFBXNQWADW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline?
The IUPAC name of 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline (CID 18726746) is 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline.
What is the SMILES notation for 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline?
The canonical SMILES for 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline is COc1nc2cc(C)c(C)c(C#CF)c2nc1OC.
What is the InChIKey of 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline?
The InChIKey is BVFNNFBXNQWADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O2/c1-8-7-11-12(10(5-6-15)9(8)2)17-14(19-4)13(16-11)18-3/h7H,1-4H3.
What are the key properties of 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline?
5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline has a molecular weight of 260.27 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoroethynyl)-2,3-dimethoxy-6,7-dimethylquinoxaline is sourced from PubChem (CID 18726746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).