About 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline
5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline (PubChem CID 18726761) has the molecular formula C12H13IN2O2
and a molecular weight of 344.15 g/mol. Its IUPAC name is 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline.
Molecular Properties
| Compound Name | 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline |
| PubChem CID | 18726761 |
| Molecular Formula | C12H13IN2O2 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline |
| SMILES | COc1nc2cc(C)c(C)c(I)c2nc1OC |
| InChI | InChI=1S/C12H13IN2O2/c1-6-5-8-10(9(13)7(6)2)15-12(17-4)11(14-8)16-3/h5H,1-4H3 |
| InChIKey | GDTXFTSRQOAFJS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline?
The IUPAC name of 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline (CID 18726761) is 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline.
What is the SMILES notation for 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline?
The canonical SMILES for 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline is COc1nc2cc(C)c(C)c(I)c2nc1OC.
What is the InChIKey of 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline?
The InChIKey is GDTXFTSRQOAFJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13IN2O2/c1-6-5-8-10(9(13)7(6)2)15-12(17-4)11(14-8)16-3/h5H,1-4H3.
What are the key properties of 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline?
5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline has a molecular weight of 344.15 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2,3-dimethoxy-6,7-dimethylquinoxaline is sourced from PubChem (CID 18726761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).