C16H20O3 — CID 18726809
2,3,5,6,7-pentamethyl-4-(oxiran-2-ylmethoxy)-1-benzofuran (PubChem CID 18726809) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2,3,5,6,7-pentamethyl-4-(oxiran-2-ylmethoxy)-1-benzofuran.
| Compound Name | 2,3,5,6,7-pentamethyl-4-(oxiran-2-ylmethoxy)-1-benzofuran |
|---|---|
| PubChem CID | 18726809 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2,3,5,6,7-pentamethyl-4-(oxiran-2-ylmethoxy)-1-benzofuran |
| SMILES | Cc1oc2c(C)c(C)c(C)c(OCC3CO3)c2c1C |
| InChI | InChI=1S/C16H20O3/c1-8-9(2)15(18-7-13-6-17-13)14-11(4)12(5)19-16(14)10(8)3/h13H,6-7H2,1-5H3 |
| InChIKey | PXIAMOVQRNBIRU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|