About 3H-inden-5-ylmethanamine
3H-inden-5-ylmethanamine (PubChem CID 18726918) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 3H-inden-5-ylmethanamine.
Molecular Properties
| Compound Name | 3H-inden-5-ylmethanamine |
| PubChem CID | 18726918 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3H-inden-5-ylmethanamine |
| SMILES | NCc1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C10H11N/c11-7-8-4-5-9-2-1-3-10(9)6-8/h1-2,4-6H,3,7,11H2 |
| InChIKey | ZQEXYIWRTAPLIT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3H-inden-5-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-inden-5-ylmethanamine?
The IUPAC name of 3H-inden-5-ylmethanamine (CID 18726918) is 3H-inden-5-ylmethanamine.
What is the SMILES notation for 3H-inden-5-ylmethanamine?
The canonical SMILES for 3H-inden-5-ylmethanamine is NCc1ccc2c(c1)CC=C2.
What is the InChIKey of 3H-inden-5-ylmethanamine?
The InChIKey is ZQEXYIWRTAPLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c11-7-8-4-5-9-2-1-3-10(9)6-8/h1-2,4-6H,3,7,11H2.
What are the key properties of 3H-inden-5-ylmethanamine?
3H-inden-5-ylmethanamine has a molecular weight of 145.20 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-inden-5-ylmethanamine is sourced from PubChem (CID 18726918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).