About N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine
N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine (PubChem CID 18727065) has the molecular formula C10H18N4S
and a molecular weight of 226.35 g/mol. Its IUPAC name is N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine |
| PubChem CID | 18727065 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine |
| SMILES | NCCNC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C10H18N4S/c11-3-4-12-9-1-6-14(7-2-9)10-13-5-8-15-10/h5,8-9,12H,1-4,6-7,11H2 |
| InChIKey | DYKGFYZSLFPLRY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine?
The IUPAC name of N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine (CID 18727065) is N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine is NCCNC1CCN(c2nccs2)CC1.
What is the InChIKey of N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine?
The InChIKey is DYKGFYZSLFPLRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4S/c11-3-4-12-9-1-6-14(7-2-9)10-13-5-8-15-10/h5,8-9,12H,1-4,6-7,11H2.
What are the key properties of N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine?
N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine has a molecular weight of 226.35 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethane-1,2-diamine is sourced from PubChem (CID 18727065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).