C16H29N — CID 18727328
9,10-di(propan-2-yl)-8-azatricyclo[5.3.1.03,8]undecane (PubChem CID 18727328) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 9,10-di(propan-2-yl)-8-azatricyclo[5.3.1.03,8]undecane.
| Compound Name | 9,10-di(propan-2-yl)-8-azatricyclo[5.3.1.03,8]undecane |
|---|---|
| PubChem CID | 18727328 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 9,10-di(propan-2-yl)-8-azatricyclo[5.3.1.03,8]undecane |
| SMILES | CC(C)C1C2CC3CCCC(C2)N3C1C(C)C |
| InChI | InChI=1S/C16H29N/c1-10(2)15-12-8-13-6-5-7-14(9-12)17(13)16(15)11(3)4/h10-16H,5-9H2,1-4H3 |
| InChIKey | GHJDJQBQLYAHHM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |