C16H33N2+ — CID 18727336
N-ethyl-1,2,2,3,4,5,7,7-octamethyl-1-azoniabicyclo[2.2.1]heptan-3-amine (PubChem CID 18727336) has the molecular formula C16H33N2+ and a molecular weight of 253.45 g/mol. Its IUPAC name is N-ethyl-1,2,2,3,4,5,7,7-octamethyl-1-azoniabicyclo[2.2.1]heptan-3-amine.
| Compound Name | N-ethyl-1,2,2,3,4,5,7,7-octamethyl-1-azoniabicyclo[2.2.1]heptan-3-amine |
|---|---|
| PubChem CID | 18727336 |
| Molecular Formula | C16H33N2+ |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.26 |
| IUPAC Name | N-ethyl-1,2,2,3,4,5,7,7-octamethyl-1-azoniabicyclo[2.2.1]heptan-3-amine |
| SMILES | CCNC1(C)C2(C)C(C)C[N+](C)(C1(C)C)C2(C)C |
| InChI | InChI=1S/C16H33N2/c1-10-17-16(8)14(5,6)18(9)11-12(2)15(16,7)13(18,3)4/h12,17H,10-11H2,1-9H3/q+1 |
| InChIKey | SWFQYCYJLSODNU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|