C30H30ClNO4 — CID 18727417
3-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-5-methylhexan-2-one (PubChem CID 18727417) has the molecular formula C30H30ClNO4 and a molecular weight of 504.03 g/mol. Its IUPAC name is 3-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-5-methylhexan-2-one.
| Compound Name | 3-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-5-methylhexan-2-one |
|---|---|
| PubChem CID | 18727417 |
| Molecular Formula | C30H30ClNO4 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 3-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-5-methylhexan-2-one |
| SMILES | CC(=O)C(CC(C)C)Oc1ccc(Cl)cc1COc1cccc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C30H30ClNO4/c1-20(2)15-30(21(3)33)36-29-14-12-24(31)16-23(29)18-34-26-8-6-9-27(17-26)35-19-25-13-11-22-7-4-5-10-28(22)32-25/h4-14,16-17,20,30H,15,18-19H2,1-3H3 |
| InChIKey | UKGCRMTWUCYMIB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |