About 1-cyclohexylethanimine
1-cyclohexylethanimine (PubChem CID 18727539) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 1-cyclohexylethanimine.
Molecular Properties
| Compound Name | 1-cyclohexylethanimine |
| PubChem CID | 18727539 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 1-cyclohexylethanimine |
| SMILES | [H]/N=C(\C)C1CCCCC1 |
| InChI | InChI=1S/C8H15N/c1-7(9)8-5-3-2-4-6-8/h8-9H,2-6H2,1H3/b9-7+ |
| InChIKey | AQBCRCZZZSCWBK-VQHVLOKHSA-N |
| XLogP | 2.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanimine?
The IUPAC name of 1-cyclohexylethanimine (CID 18727539) is 1-cyclohexylethanimine.
What is the SMILES notation for 1-cyclohexylethanimine?
The canonical SMILES for 1-cyclohexylethanimine is [H]/N=C(\C)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethanimine?
The InChIKey is AQBCRCZZZSCWBK-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H15N/c1-7(9)8-5-3-2-4-6-8/h8-9H,2-6H2,1H3/b9-7+.
What are the key properties of 1-cyclohexylethanimine?
1-cyclohexylethanimine has a molecular weight of 125.21 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanimine is sourced from PubChem (CID 18727539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).