C21H17ClFN5O2 — CID 18727588
2-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-N-(5-chloro-2-pyridinyl)-5-methylbenzamide (PubChem CID 18727588) has the molecular formula C21H17ClFN5O2 and a molecular weight of 425.85 g/mol. Its IUPAC name is 2-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-N-(5-chloro-2-pyridinyl)-5-methylbenzamide.
| Compound Name | 2-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-N-(5-chloro-2-pyridinyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 18727588 |
| Molecular Formula | C21H17ClFN5O2 |
| Molecular Weight | 425.85 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[(4-carbamimidoyl-2-fluorobenzoyl)amino]-N-(5-chloro-2-pyridinyl)-5-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Nc2ccc(C)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C21H17ClFN5O2/c1-11-2-6-17(15(8-11)21(30)28-18-7-4-13(22)10-26-18)27-20(29)14-5-3-12(19(24)25)9-16(14)23/h2-10H,1H3,(H3,24,25)(H,27,29)(H,26,28,30) |
| InChIKey | IPRCOKKHZOGTBC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|