C24H22Cl2FN5O3 — CID 18727821
5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-methoxybenzamide (PubChem CID 18727821) has the molecular formula C24H22Cl2FN5O3 and a molecular weight of 518.38 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-methoxybenzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 18727821 |
| Molecular Formula | C24H22Cl2FN5O3 |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-methoxybenzamide |
| SMILES | C/N=C(/c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C24H22Cl2FN5O3/c1-28-22(32(2)3)13-5-7-16(18(27)9-13)23(33)31-21-17(10-15(26)11-19(21)35-4)24(34)30-20-8-6-14(25)12-29-20/h5-12H,1-4H3,(H,31,33)(H,29,30,34)/b28-22- |
| InChIKey | LCMHYLRQELTJJK-SLMZUGIISA-N |
| XLogP | 4.98 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|