C24H19Cl2F4N5O3 — CID 18727822
5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-(trifluoromethoxy)benzamide (PubChem CID 18727822) has the molecular formula C24H19Cl2F4N5O3 and a molecular weight of 572.35 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-(trifluoromethoxy)benzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 18727822 |
| Molecular Formula | C24H19Cl2F4N5O3 |
| Molecular Weight | 572.35 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[[2-fluoro-4-(N,N,N'-trimethylcarbamimidoyl)benzoyl]amino]-3-(trifluoromethoxy)benzamide |
| SMILES | C/N=C(/c1ccc(C(=O)Nc2c(OC(F)(F)F)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C24H19Cl2F4N5O3/c1-31-21(35(2)3)12-4-6-15(17(27)8-12)22(36)34-20-16(9-14(26)10-18(20)38-24(28,29)30)23(37)33-19-7-5-13(25)11-32-19/h4-11H,1-3H3,(H,34,36)(H,32,33,37)/b31-21- |
| InChIKey | NMDYSXJHKXXONI-YQYKVWLJSA-N |
| XLogP | 5.87 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|