About 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene
2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 18727892) has the molecular formula C9H12S
and a molecular weight of 152.26 g/mol. Its IUPAC name is 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene.
Molecular Properties
| Compound Name | 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
| PubChem CID | 18727892 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | Cc1sc2c(c1C)CCC2 |
| InChI | InChI=1S/C9H12S/c1-6-7(2)10-9-5-3-4-8(6)9/h3-5H2,1-2H3 |
| InChIKey | BEAIWOQOBGBGFM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The IUPAC name of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene (CID 18727892) is 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene.
What is the SMILES notation for 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The canonical SMILES for 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene is Cc1sc2c(c1C)CCC2.
What is the InChIKey of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The InChIKey is BEAIWOQOBGBGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S/c1-6-7(2)10-9-5-3-4-8(6)9/h3-5H2,1-2H3.
What are the key properties of 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene has a molecular weight of 152.26 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5,6-dihydro-4H-cyclopenta[b]thiophene is sourced from PubChem (CID 18727892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).