About N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine
N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 18727981) has the molecular formula C8H20N2O
and a molecular weight of 160.26 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine |
| PubChem CID | 18727981 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | COCCN(C)CCN(C)C |
| InChI | InChI=1S/C8H20N2O/c1-9(2)5-6-10(3)7-8-11-4/h5-8H2,1-4H3 |
| InChIKey | MTLIMQLLPZHSAJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
The IUPAC name of N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine (CID 18727981) is N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine.
What is the SMILES notation for N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
The canonical SMILES for N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine is COCCN(C)CCN(C)C.
What is the InChIKey of N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
The InChIKey is MTLIMQLLPZHSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O/c1-9(2)5-6-10(3)7-8-11-4/h5-8H2,1-4H3.
What are the key properties of N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine?
N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine has a molecular weight of 160.26 g/mol, XLogP of 0.13, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N,N,N'-trimethylethane-1,2-diamine is sourced from PubChem (CID 18727981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).