About N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine
N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine (PubChem CID 18728198) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 18728198 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCN(C)C1=NCCN1C |
| InChI | InChI=1S/C7H15N3/c1-4-9(2)7-8-5-6-10(7)3/h4-6H2,1-3H3 |
| InChIKey | WTDGBRNUDJCFPC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine (CID 18728198) is N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine is CCN(C)C1=NCCN1C.
What is the InChIKey of N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine?
The InChIKey is WTDGBRNUDJCFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-4-9(2)7-8-5-6-10(7)3/h4-6H2,1-3H3.
What are the key properties of N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine?
N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine has a molecular weight of 141.22 g/mol, XLogP of 0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N,1-dimethyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 18728198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).