C36H49NO5 — CID 18728296
13,13,16-trimethyl-2-(2-phenylethyl)-3,15-dioxa-10-azatricyclo[22.3.1.05,10]octacosa-1(27),24(28),25-triene-4,11,12-trione (PubChem CID 18728296) has the molecular formula C36H49NO5 and a molecular weight of 575.79 g/mol. Its IUPAC name is 13,13,16-trimethyl-2-(2-phenylethyl)-3,15-dioxa-10-azatricyclo[22.3.1.05,10]octacosa-1(27),24(28),25-triene-4,11,12-trione.
| Compound Name | 13,13,16-trimethyl-2-(2-phenylethyl)-3,15-dioxa-10-azatricyclo[22.3.1.05,10]octacosa-1(27),24(28),25-triene-4,11,12-trione |
|---|---|
| PubChem CID | 18728296 |
| Molecular Formula | C36H49NO5 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.36 |
| IUPAC Name | 13,13,16-trimethyl-2-(2-phenylethyl)-3,15-dioxa-10-azatricyclo[22.3.1.05,10]octacosa-1(27),24(28),25-triene-4,11,12-trione |
| SMILES | CC1CCCCCCCc2cccc(c2)C(CCc2ccccc2)OC(=O)C2CCCCN2C(=O)C(=O)C(C)(C)CO1 |
| InChI | InChI=1S/C36H49NO5/c1-27-15-8-5-4-6-9-18-29-19-14-20-30(25-29)32(23-22-28-16-10-7-11-17-28)42-35(40)31-21-12-13-24-37(31)34(39)33(38)36(2,3)26-41-27/h7,10-11,14,16-17,19-20,25,27,31-32H,4-6,8-9,12-13,15,18,21-24,26H2,1-3H3 |
| InChIKey | XDWLSYJEJCHHEN-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|