C25H50N2O2 — CID 18728782
1-[2,2-dimethyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,4,6,6-pentamethylpiperidine (PubChem CID 18728782) has the molecular formula C25H50N2O2 and a molecular weight of 410.69 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,4,6,6-pentamethylpiperidine.
| Compound Name | 1-[2,2-dimethyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,4,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 18728782 |
| Molecular Formula | C25H50N2O2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | 1-[2,2-dimethyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,4,6,6-pentamethylpiperidine |
| SMILES | CC1CC(C)(C)N(OCC(C)(C)CON2C(C)(C)CC(C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C25H50N2O2/c1-19-13-22(5,6)26(23(7,8)14-19)28-17-21(3,4)18-29-27-24(9,10)15-20(2)16-25(27,11)12/h19-20H,13-18H2,1-12H3 |
| InChIKey | BWBGYZMPCVICPM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |