C23H46N2O4 — CID 18728784
1-[2-hydroxy-2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 18728784) has the molecular formula C23H46N2O4 and a molecular weight of 414.63 g/mol. Its IUPAC name is 1-[2-hydroxy-2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[2-hydroxy-2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 18728784 |
| Molecular Formula | C23H46N2O4 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | 1-[2-hydroxy-2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1CC(C)(C)N(OCC(C)(O)CON2C(C)(C)CC(O)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C23H46N2O4/c1-17-11-19(2,3)24(20(4,5)12-17)28-15-23(10,27)16-29-25-21(6,7)13-18(26)14-22(25,8)9/h17-18,26-27H,11-16H2,1-10H3 |
| InChIKey | XZTDRTGUYALNCH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |