C24H48N2O3 — CID 18728801
2-methyl-1,3-bis[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxy]propan-2-ol (PubChem CID 18728801) has the molecular formula C24H48N2O3 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2-methyl-1,3-bis[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxy]propan-2-ol.
| Compound Name | 2-methyl-1,3-bis[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 18728801 |
| Molecular Formula | C24H48N2O3 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | 2-methyl-1,3-bis[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxy]propan-2-ol |
| SMILES | CC1CC(C)(C)N(OCC(C)(O)CON2C(C)(C)CC(C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C24H48N2O3/c1-18-12-20(3,4)25(21(5,6)13-18)28-16-24(11,27)17-29-26-22(7,8)14-19(2)15-23(26,9)10/h18-19,27H,12-17H2,1-11H3 |
| InChIKey | GFKDLPGWDPKUNU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |