C36H65N7O2 — CID 18728806
2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N,6-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 18728806) has the molecular formula C36H65N7O2 and a molecular weight of 627.96 g/mol. Its IUPAC name is 2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N,6-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N,6-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 18728806 |
| Molecular Formula | C36H65N7O2 |
| Molecular Weight | 627.96 g/mol |
| Exact Mass | 627.52 |
| IUPAC Name | 2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-2-N,4-N,6-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(N(C)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)nc(N(C)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1 |
| InChI | InChI=1S/C36H65N7O2/c1-26-37-31(40(10)27-22-33(2,3)42(34(4,5)23-27)44-29-18-14-12-15-19-29)39-32(38-26)41(11)28-24-35(6,7)43(36(8,9)25-28)45-30-20-16-13-17-21-30/h27-30H,12-25H2,1-11H3 |
| InChIKey | XPWMVZDDBFSEPM-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.96 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |