C14H19FO2S — CID 18729283
2-fluoro-4-methoxy-5,6-dimethyl-3-phenylsulfanyloxane (PubChem CID 18729283) has the molecular formula C14H19FO2S and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-5,6-dimethyl-3-phenylsulfanyloxane.
| Compound Name | 2-fluoro-4-methoxy-5,6-dimethyl-3-phenylsulfanyloxane |
|---|---|
| PubChem CID | 18729283 |
| Molecular Formula | C14H19FO2S |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-fluoro-4-methoxy-5,6-dimethyl-3-phenylsulfanyloxane |
| SMILES | COC1C(C)C(C)OC(F)C1Sc1ccccc1 |
| InChI | InChI=1S/C14H19FO2S/c1-9-10(2)17-14(15)13(12(9)16-3)18-11-7-5-4-6-8-11/h4-10,12-14H,1-3H3 |
| InChIKey | KBOSYKSYBNDJBU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |