C8H16N2O3 — CID 18729408
N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2-dimethylpropanamide (PubChem CID 18729408) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2-dimethylpropanamide.
| Compound Name | N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18729408 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | N-[1-(hydroxyamino)-1-oxopropan-2-yl]-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)C(C)C(=O)NO |
| InChI | InChI=1S/C8H16N2O3/c1-5(2)8(12)10(4)6(3)7(11)9-13/h5-6,13H,1-4H3,(H,9,11) |
| InChIKey | VPBBORSUDRVKLG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|