C13H25N — CID 18730034
1,2,2,3,3,4,4,5-octamethylpyridine (PubChem CID 18730034) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5-octamethylpyridine.
| Compound Name | 1,2,2,3,3,4,4,5-octamethylpyridine |
|---|---|
| PubChem CID | 18730034 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1,2,2,3,3,4,4,5-octamethylpyridine |
| SMILES | CC1=CN(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H25N/c1-10-9-14(8)13(6,7)12(4,5)11(10,2)3/h9H,1-8H3 |
| InChIKey | BGEUEMYNBZEVPS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |