C28H23ClN2O3S — CID 18730349
3-[(2Z)-2-[(E)-3-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propanoate (PubChem CID 18730349) has the molecular formula C28H23ClN2O3S and a molecular weight of 503.02 g/mol. Its IUPAC name is 3-[(2Z)-2-[(E)-3-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propanoate.
| Compound Name | 3-[(2Z)-2-[(E)-3-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propanoate |
|---|---|
| PubChem CID | 18730349 |
| Molecular Formula | C28H23ClN2O3S |
| Molecular Weight | 503.02 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 3-[(2Z)-2-[(E)-3-(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propanoate |
| SMILES | CC[n+]1c(/C=C/C=C2\Oc3ccc(-c4ccccc4)cc3N2CCC(=O)[O-])sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C28H23ClN2O3S/c1-2-30-23-18-21(29)12-14-25(23)35-27(30)10-6-9-26-31(16-15-28(32)33)22-17-20(11-13-24(22)34-26)19-7-4-3-5-8-19/h3-14,17-18H,2,15-16H2,1H3 |
| InChIKey | QBDDQWVNFZMYTF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.02 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|