About 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine
2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 18730596) has the molecular formula C8H21N5O2
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine |
| PubChem CID | 18730596 |
| Molecular Formula | C8H21N5O2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CC(CN(C)C)N(CN(C)C)/N=N/OO |
| InChI | InChI=1S/C8H21N5O2/c1-8(6-11(2)3)13(7-12(4)5)9-10-15-14/h8,14H,6-7H2,1-5H3/b10-9+ |
| InChIKey | UQYDRFOILSVZRD-MDZDMXLPSA-N |
| XLogP | 0.53 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine?
The IUPAC name of 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine (CID 18730596) is 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine.
What is the SMILES notation for 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine?
The canonical SMILES for 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine is CC(CN(C)C)N(CN(C)C)/N=N/OO.
What is the InChIKey of 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine?
The InChIKey is UQYDRFOILSVZRD-MDZDMXLPSA-N. The full InChI is InChI=1S/C8H21N5O2/c1-8(6-11(2)3)13(7-12(4)5)9-10-15-14/h8,14H,6-7H2,1-5H3/b10-9+.
What are the key properties of 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine?
2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine has a molecular weight of 219.29 g/mol, XLogP of 0.53, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(dimethylamino)methyl]-2-N-[(E)-hydroperoxydiazenyl]-1-N,1-N-dimethylpropane-1,2-diamine is sourced from PubChem (CID 18730596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).