C22H49NO10Si3 — CID 18730823
trimethoxy-[4-[1-methoxy-7-methyl-10-(4-trimethoxysilylbutyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl]butyl]silane (PubChem CID 18730823) has the molecular formula C22H49NO10Si3 and a molecular weight of 571.89 g/mol. Its IUPAC name is trimethoxy-[4-[1-methoxy-7-methyl-10-(4-trimethoxysilylbutyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl]butyl]silane.
| Compound Name | trimethoxy-[4-[1-methoxy-7-methyl-10-(4-trimethoxysilylbutyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl]butyl]silane |
|---|---|
| PubChem CID | 18730823 |
| Molecular Formula | C22H49NO10Si3 |
| Molecular Weight | 571.89 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | trimethoxy-[4-[1-methoxy-7-methyl-10-(4-trimethoxysilylbutyl)-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-3-yl]butyl]silane |
| SMILES | CO[Si](CCCCC1CN2CC(C)O[Si](OC)(O1)OC(CCCC[Si](OC)(OC)OC)C2)(OC)OC |
| InChI | InChI=1S/C22H49NO10Si3/c1-20-17-23-18-21(13-9-11-15-34(24-2,25-3)26-4)32-36(30-8,31-20)33-22(19-23)14-10-12-16-35(27-5,28-6)29-7/h20-22H,9-19H2,1-8H3 |
| InChIKey | WRTLVBVIECIHGQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.89 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|