C63H96O4 — CID 18730955
bis[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nona-3,6-diynedioate (PubChem CID 18730955) has the molecular formula C63H96O4 and a molecular weight of 917.46 g/mol. Its IUPAC name is bis[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nona-3,6-diynedioate.
| Compound Name | bis[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nona-3,6-diynedioate |
|---|---|
| PubChem CID | 18730955 |
| Molecular Formula | C63H96O4 |
| Molecular Weight | 917.46 g/mol |
| Exact Mass | 916.73 |
| IUPAC Name | bis[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nona-3,6-diynedioate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CC#CCC#CCC(=O)OC5CCC6(C)C(=CCC7C6CCC6(C)C(C(C)CCCC(C)C)CCC76)C5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C63H96O4/c1-42(2)18-16-20-44(5)52-28-30-54-50-26-24-46-40-48(32-36-60(46,7)56(50)34-38-62(52,54)9)66-58(64)22-14-12-11-13-15-23-59(65)67-49-33-37-61(8)47(41-49)25-27-51-55-31-29-53(45(6)21-17-19-43(3)4)63(55,10)39-35-57(51)61/h24-25,42-45,48-57H,11,16-23,26-41H2,1-10H3 |
| InChIKey | PWOQFPZHXHUQCI-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.46 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|