About furan-2-carbohydrazide
furan-2-carbohydrazide (PubChem CID 18731) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is furan-2-carbohydrazide.
Molecular Properties
| Compound Name | furan-2-carbohydrazide |
| PubChem CID | 18731 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | furan-2-carbohydrazide |
| SMILES | NNC(=O)c1ccco1 |
| InChI | InChI=1S/C5H6N2O2/c6-7-5(8)4-2-1-3-9-4/h1-3H,6H2,(H,7,8) |
| InChIKey | SKTSVWWOAIAIKI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carbohydrazide?
The IUPAC name of furan-2-carbohydrazide (CID 18731) is furan-2-carbohydrazide.
What is the SMILES notation for furan-2-carbohydrazide?
The canonical SMILES for furan-2-carbohydrazide is NNC(=O)c1ccco1.
What is the InChIKey of furan-2-carbohydrazide?
The InChIKey is SKTSVWWOAIAIKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c6-7-5(8)4-2-1-3-9-4/h1-3H,6H2,(H,7,8).
What are the key properties of furan-2-carbohydrazide?
furan-2-carbohydrazide has a molecular weight of 126.11 g/mol, XLogP of -0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carbohydrazide is sourced from PubChem (CID 18731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).