C50H74N6O6S2 — CID 18731211
2-[3,5-bis[(5-tert-butyl-2-octoxyphenoxy)sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 18731211) has the molecular formula C50H74N6O6S2 and a molecular weight of 919.31 g/mol. Its IUPAC name is 2-[3,5-bis[(5-tert-butyl-2-octoxyphenoxy)sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 2-[3,5-bis[(5-tert-butyl-2-octoxyphenoxy)sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 18731211 |
| Molecular Formula | C50H74N6O6S2 |
| Molecular Weight | 919.31 g/mol |
| Exact Mass | 918.51 |
| IUPAC Name | 2-[3,5-bis[(5-tert-butyl-2-octoxyphenoxy)sulfinylamino]phenyl]-6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)C)cc1OS(=O)Nc1cc(NS(=O)Oc2cc(C(C)(C)C)ccc2OCCCCCCCC)cc(-c2nc3cc(C(C)(C)C)[nH]n3n2)c1 |
| InChI | InChI=1S/C50H74N6O6S2/c1-12-14-16-18-20-22-28-59-41-26-24-37(48(3,4)5)32-43(41)61-63(57)54-39-30-36(47-51-46-35-45(50(9,10)11)52-56(46)53-47)31-40(34-39)55-64(58)62-44-33-38(49(6,7)8)25-27-42(44)60-29-23-21-19-17-15-13-2/h24-27,30-35,52,54-55H,12-23,28-29H2,1-11H3 |
| InChIKey | NESSCDHYFYUYTI-UHFFFAOYSA-N |
| XLogP | 13.23 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.31 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|