About (Z)-1,4-dihydroperoxy-2-methylbut-2-ene
(Z)-1,4-dihydroperoxy-2-methylbut-2-ene (PubChem CID 18731330) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is (Z)-1,4-dihydroperoxy-2-methylbut-2-ene.
Molecular Properties
| Compound Name | (Z)-1,4-dihydroperoxy-2-methylbut-2-ene |
| PubChem CID | 18731330 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (Z)-1,4-dihydroperoxy-2-methylbut-2-ene |
| SMILES | C/C(=C/COO)COO |
| InChI | InChI=1S/C5H10O4/c1-5(4-9-7)2-3-8-6/h2,6-7H,3-4H2,1H3/b5-2- |
| InChIKey | HBRLJVHPPSFBQD-DJWKRKHSSA-N |
| XLogP | 0.91 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,4-dihydroperoxy-2-methylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,4-dihydroperoxy-2-methylbut-2-ene?
The IUPAC name of (Z)-1,4-dihydroperoxy-2-methylbut-2-ene (CID 18731330) is (Z)-1,4-dihydroperoxy-2-methylbut-2-ene.
What is the SMILES notation for (Z)-1,4-dihydroperoxy-2-methylbut-2-ene?
The canonical SMILES for (Z)-1,4-dihydroperoxy-2-methylbut-2-ene is C/C(=C/COO)COO.
What is the InChIKey of (Z)-1,4-dihydroperoxy-2-methylbut-2-ene?
The InChIKey is HBRLJVHPPSFBQD-DJWKRKHSSA-N. The full InChI is InChI=1S/C5H10O4/c1-5(4-9-7)2-3-8-6/h2,6-7H,3-4H2,1H3/b5-2-.
What are the key properties of (Z)-1,4-dihydroperoxy-2-methylbut-2-ene?
(Z)-1,4-dihydroperoxy-2-methylbut-2-ene has a molecular weight of 134.13 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,4-dihydroperoxy-2-methylbut-2-ene is sourced from PubChem (CID 18731330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).