C14H20N2O2S4 — CID 18731422
2-(3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylsulfonylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole (PubChem CID 18731422) has the molecular formula C14H20N2O2S4 and a molecular weight of 376.59 g/mol. Its IUPAC name is 2-(3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylsulfonylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole.
| Compound Name | 2-(3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylsulfonylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 18731422 |
| Molecular Formula | C14H20N2O2S4 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylsulfonylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
| SMILES | O=S(=O)(SC1=NC2CCCCC2S1)C1=NC2CCCCC2S1 |
| InChI | InChI=1S/C14H20N2O2S4/c17-22(18,14-16-10-6-2-4-8-12(10)20-14)21-13-15-9-5-1-3-7-11(9)19-13/h9-12H,1-8H2 |
| InChIKey | RYTISFQHGPSLGH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|