About N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide
N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide (PubChem CID 18731490) has the molecular formula C13H21N5O2
and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide |
| PubChem CID | 18731490 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide |
| SMILES | CCC(C)N1C=NC2C(=O)NC(NC(=O)C(C)C)=NC21 |
| InChI | InChI=1S/C13H21N5O2/c1-5-8(4)18-6-14-9-10(18)15-13(17-12(9)20)16-11(19)7(2)3/h6-10H,5H2,1-4H3,(H2,15,16,17,19,20) |
| InChIKey | VASSBYJELQPUGM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
The IUPAC name of N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide (CID 18731490) is N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide.
What is the SMILES notation for N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
The canonical SMILES for N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide is CCC(C)N1C=NC2C(=O)NC(NC(=O)C(C)C)=NC21.
What is the InChIKey of N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
The InChIKey is VASSBYJELQPUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O2/c1-5-8(4)18-6-14-9-10(18)15-13(17-12(9)20)16-11(19)7(2)3/h6-10H,5H2,1-4H3,(H2,15,16,17,19,20).
What are the key properties of N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide has a molecular weight of 279.34 g/mol, XLogP of 0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-butan-2-yl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide is sourced from PubChem (CID 18731490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).