C10H15N — CID 18731611
3,4,5-trimethyl-2,6-dimethylidene-3H-pyridine (PubChem CID 18731611) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 3,4,5-trimethyl-2,6-dimethylidene-3H-pyridine.
| Compound Name | 3,4,5-trimethyl-2,6-dimethylidene-3H-pyridine |
|---|---|
| PubChem CID | 18731611 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3,4,5-trimethyl-2,6-dimethylidene-3H-pyridine |
| SMILES | C=C1NC(=C)C(C)C(C)=C1C |
| InChI | InChI=1S/C10H15N/c1-6-7(2)9(4)11-10(5)8(6)3/h7,11H,4-5H2,1-3H3 |
| InChIKey | JYFQBDOQYNGGNQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |