C14H15F3N4O2 — CID 18731694
2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione (PubChem CID 18731694) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione.
| Compound Name | 2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
|---|---|
| PubChem CID | 18731694 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
| SMILES | Cc1cc(C(F)(F)F)c(C)nc1-n1c(=O)n2n(c1=O)CCCC2 |
| InChI | InChI=1S/C14H15F3N4O2/c1-8-7-10(14(15,16)17)9(2)18-11(8)21-12(22)19-5-3-4-6-20(19)13(21)23/h7H,3-6H2,1-2H3 |
| InChIKey | WWAQCBIMLHKPMA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |