C8H14F4N2O — CID 18731750
1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine (PubChem CID 18731750) has the molecular formula C8H14F4N2O and a molecular weight of 230.20 g/mol. Its IUPAC name is 1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine.
| Compound Name | 1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine |
|---|---|
| PubChem CID | 18731750 |
| Molecular Formula | C8H14F4N2O |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine |
| SMILES | COC(F)(F)C(F)(F)N1CCN(C)CC1 |
| InChI | InChI=1S/C8H14F4N2O/c1-13-3-5-14(6-4-13)7(9,10)8(11,12)15-2/h3-6H2,1-2H3 |
| InChIKey | WSYUTGSIPOBZJL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|