About 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane
8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 18731882) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane |
| PubChem CID | 18731882 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CC(C)N1CC2CCC(C1)N2C |
| InChI | InChI=1S/C10H20N2/c1-8(2)12-6-9-4-5-10(7-12)11(9)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | XPXILEZLUQUOLX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane?
The IUPAC name of 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane (CID 18731882) is 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane?
The canonical SMILES for 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane is CC(C)N1CC2CCC(C1)N2C.
What is the InChIKey of 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane?
The InChIKey is XPXILEZLUQUOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-8(2)12-6-9-4-5-10(7-12)11(9)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane?
8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane has a molecular weight of 168.28 g/mol, XLogP of 1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 18731882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).