About 3-methyl-1,3-oxazepane-2,4-dione
3-methyl-1,3-oxazepane-2,4-dione (PubChem CID 18731883) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 3-methyl-1,3-oxazepane-2,4-dione.
Molecular Properties
| Compound Name | 3-methyl-1,3-oxazepane-2,4-dione |
| PubChem CID | 18731883 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 3-methyl-1,3-oxazepane-2,4-dione |
| SMILES | CN1C(=O)CCCOC1=O |
| InChI | InChI=1S/C6H9NO3/c1-7-5(8)3-2-4-10-6(7)9/h2-4H2,1H3 |
| InChIKey | FITUIMNEBKGAIK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1,3-oxazepane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,3-oxazepane-2,4-dione?
The IUPAC name of 3-methyl-1,3-oxazepane-2,4-dione (CID 18731883) is 3-methyl-1,3-oxazepane-2,4-dione.
What is the SMILES notation for 3-methyl-1,3-oxazepane-2,4-dione?
The canonical SMILES for 3-methyl-1,3-oxazepane-2,4-dione is CN1C(=O)CCCOC1=O.
What is the InChIKey of 3-methyl-1,3-oxazepane-2,4-dione?
The InChIKey is FITUIMNEBKGAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-7-5(8)3-2-4-10-6(7)9/h2-4H2,1H3.
What are the key properties of 3-methyl-1,3-oxazepane-2,4-dione?
3-methyl-1,3-oxazepane-2,4-dione has a molecular weight of 143.14 g/mol, XLogP of 0.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,3-oxazepane-2,4-dione is sourced from PubChem (CID 18731883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).