About 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene
6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene (PubChem CID 18732232) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene.
Analyze 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene?
The IUPAC name of 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene (CID 18732232) is 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene.
What is the SMILES notation for 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene?
The canonical SMILES for 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene is C1=C2CNCc3cccc(c32)C1.
What is the InChIKey of 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene?
The InChIKey is LLFJHPLEGAZZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-2-8-4-5-10-7-12-6-9(3-1)11(8)10/h1-3,5,12H,4,6-7H2.
What are the key properties of 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene?
6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene has a molecular weight of 157.22 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene is sourced from PubChem (CID 18732232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).