C10H7N3O — CID 18732238
2,4,7-triazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-8-one (PubChem CID 18732238) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is 2,4,7-triazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-8-one.
| Compound Name | 2,4,7-triazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-8-one |
|---|---|
| PubChem CID | 18732238 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2,4,7-triazatricyclo[7.3.1.05,13]trideca-1(12),2,4,9(13),10-pentaen-8-one |
| SMILES | O=C1NCc2ncnc3cccc1c23 |
| InChI | InChI=1S/C10H7N3O/c14-10-6-2-1-3-7-9(6)8(4-11-10)13-5-12-7/h1-3,5H,4H2,(H,11,14) |
| InChIKey | GAIZBRJYMVTQRF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |