About 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene
2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene (PubChem CID 18732241) has the molecular formula C10H11NS
and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene.
Analyze 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene?
The IUPAC name of 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene (CID 18732241) is 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene.
What is the SMILES notation for 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene?
The canonical SMILES for 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene is c1cc2c3c(c1)SCC3CNC2.
What is the InChIKey of 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene?
The InChIKey is BHNWSHWKAJOBOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS/c1-2-7-4-11-5-8-6-12-9(3-1)10(7)8/h1-3,8,11H,4-6H2.
What are the key properties of 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene?
2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene has a molecular weight of 177.27 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene is sourced from PubChem (CID 18732241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).