C35H38FN5O5S — CID 18732358
4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 18732358) has the molecular formula C35H38FN5O5S and a molecular weight of 659.78 g/mol. Its IUPAC name is 4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18732358 |
| Molecular Formula | C35H38FN5O5S |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | 4-[[6-[5-(1,3-dioxoisoindol-2-yl)pentylsulfonylamino]-1H-benzimidazol-2-yl]methyl]-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1ccccc1F)C1CCC(Cc2nc3ccc(NS(=O)(=O)CCCCCN4C(=O)c5ccccc5C4=O)cc3[nH]2)CC1 |
| InChI | InChI=1S/C35H38FN5O5S/c36-29-11-5-2-8-25(29)22-37-33(42)24-14-12-23(13-15-24)20-32-38-30-17-16-26(21-31(30)39-32)40-47(45,46)19-7-1-6-18-41-34(43)27-9-3-4-10-28(27)35(41)44/h2-5,8-11,16-17,21,23-24,40H,1,6-7,12-15,18-20,22H2,(H,37,42)(H,38,39) |
| InChIKey | MALVFTUCWMAATD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|