C25H28F4N4O — CID 18734077
N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2-fluoro-N-pentyl-6-(trifluoromethyl)benzamide (PubChem CID 18734077) has the molecular formula C25H28F4N4O and a molecular weight of 476.52 g/mol. Its IUPAC name is N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2-fluoro-N-pentyl-6-(trifluoromethyl)benzamide.
| Compound Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2-fluoro-N-pentyl-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18734077 |
| Molecular Formula | C25H28F4N4O |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[(3-cyclopentylimidazo[4,5-b]pyridin-2-yl)methyl]-2-fluoro-N-pentyl-6-(trifluoromethyl)benzamide |
| SMILES | CCCCCN(Cc1nc2cccnc2n1C1CCCC1)C(=O)c1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C25H28F4N4O/c1-2-3-6-15-32(24(34)22-18(25(27,28)29)11-7-12-19(22)26)16-21-31-20-13-8-14-30-23(20)33(21)17-9-4-5-10-17/h7-8,11-14,17H,2-6,9-10,15-16H2,1H3 |
| InChIKey | ZSJIXGPQXSFFCR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|