About N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide
N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide (PubChem CID 18734522) has the molecular formula C22H23ClF3N3O
and a molecular weight of 437.89 g/mol. Its IUPAC name is N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide.
Molecular Properties
| Compound Name | N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide |
| PubChem CID | 18734522 |
| Molecular Formula | C22H23ClF3N3O |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide |
| SMILES | CCCCN(Cc1nc2ccc(Cl)cc2n1CCC)C(=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C22H23ClF3N3O/c1-3-5-11-28(22(30)20-15(24)7-8-16(25)21(20)26)13-19-27-17-9-6-14(23)12-18(17)29(19)10-4-2/h6-9,12H,3-5,10-11,13H2,1-2H3 |
| InChIKey | HECCCPRUPPXEFA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide?
The IUPAC name of N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide (CID 18734522) is N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide.
What is the SMILES notation for N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide?
The canonical SMILES for N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide is CCCCN(Cc1nc2ccc(Cl)cc2n1CCC)C(=O)c1c(F)ccc(F)c1F.
What is the InChIKey of N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide?
The InChIKey is HECCCPRUPPXEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClF3N3O/c1-3-5-11-28(22(30)20-15(24)7-8-16(25)21(20)26)13-19-27-17-9-6-14(23)12-18(17)29(19)10-4-2/h6-9,12H,3-5,10-11,13H2,1-2H3.
What are the key properties of N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide?
N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide has a molecular weight of 437.89 g/mol, XLogP of 5.96, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide is sourced from PubChem (CID 18734522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).