C22H23ClF3N3O — CID 18734522
N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide (PubChem CID 18734522) has the molecular formula C22H23ClF3N3O and a molecular weight of 437.89 g/mol. Its IUPAC name is N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide.
| Compound Name | N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide |
|---|---|
| PubChem CID | 18734522 |
| Molecular Formula | C22H23ClF3N3O |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-butyl-N-[(6-chloro-1-propylbenzimidazol-2-yl)methyl]-2,3,6-trifluorobenzamide |
| SMILES | CCCCN(Cc1nc2ccc(Cl)cc2n1CCC)C(=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C22H23ClF3N3O/c1-3-5-11-28(22(30)20-15(24)7-8-16(25)21(20)26)13-19-27-17-9-6-14(23)12-18(17)29(19)10-4-2/h6-9,12H,3-5,10-11,13H2,1-2H3 |
| InChIKey | HECCCPRUPPXEFA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|