C21H27FN4O — CID 18735085
2-(4-aminopiperidin-1-yl)-N-[2-(4-fluorophenyl)-3-pyridin-3-ylpropyl]acetamide (PubChem CID 18735085) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N-[2-(4-fluorophenyl)-3-pyridin-3-ylpropyl]acetamide.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N-[2-(4-fluorophenyl)-3-pyridin-3-ylpropyl]acetamide |
|---|---|
| PubChem CID | 18735085 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N-[2-(4-fluorophenyl)-3-pyridin-3-ylpropyl]acetamide |
| SMILES | NC1CCN(CC(=O)NCC(Cc2cccnc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H27FN4O/c22-19-5-3-17(4-6-19)18(12-16-2-1-9-24-13-16)14-25-21(27)15-26-10-7-20(23)8-11-26/h1-6,9,13,18,20H,7-8,10-12,14-15,23H2,(H,25,27) |
| InChIKey | XSQNQKIFYLCTKI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |