C11H10NNaO2 — CID 18735252
sodium 2-(2-methylindol-1-yl)acetate (PubChem CID 18735252) has the molecular formula C11H10NNaO2 and a molecular weight of 211.20 g/mol. Its IUPAC name is sodium 2-(2-methylindol-1-yl)acetate.
| Compound Name | sodium 2-(2-methylindol-1-yl)acetate |
|---|---|
| PubChem CID | 18735252 |
| Molecular Formula | C11H10NNaO2 |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | sodium 2-(2-methylindol-1-yl)acetate |
| SMILES | Cc1cc2ccccc2n1CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H11NO2.Na/c1-8-6-9-4-2-3-5-10(9)12(8)7-11(13)14;/h2-6H,7H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | JFKHUPUKIOQQBZ-UHFFFAOYSA-M |
| XLogP | -2.30 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |