C36H48FN3O6 — CID 18735392
(2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-(4,4-dimethyl-2-oxopyrrolidin-1-yl)ethyl]-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 18735392) has the molecular formula C36H48FN3O6 and a molecular weight of 637.79 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-(4,4-dimethyl-2-oxopyrrolidin-1-yl)ethyl]-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-(4,4-dimethyl-2-oxopyrrolidin-1-yl)ethyl]-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 18735392 |
| Molecular Formula | C36H48FN3O6 |
| Molecular Weight | 637.79 g/mol |
| Exact Mass | 637.35 |
| IUPAC Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-2-[2-(4,4-dimethyl-2-oxopyrrolidin-1-yl)ethyl]-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCC(CCC)N(C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1CCN1CC(C)(C)CC1=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C36H48FN3O6/c1-6-8-25(9-7-2)40(26-11-12-28(37)23(3)16-26)33(42)20-39-19-27(24-10-13-30-31(17-24)46-22-45-30)34(35(43)44)29(39)14-15-38-21-36(4,5)18-32(38)41/h10-13,16-17,25,27,29,34H,6-9,14-15,18-22H2,1-5H3,(H,43,44)/t27-,29-,34+/m1/s1 |
| InChIKey | XLJPXXJNDYHYCH-KUCNLHCJSA-N |
| XLogP | 5.98 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.79 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |