About 1,2,3,4-tetramethylpyrrolidine
1,2,3,4-tetramethylpyrrolidine (PubChem CID 18735418) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is 1,2,3,4-tetramethylpyrrolidine.
Molecular Properties
| Compound Name | 1,2,3,4-tetramethylpyrrolidine |
| PubChem CID | 18735418 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 1,2,3,4-tetramethylpyrrolidine |
| SMILES | CC1CN(C)C(C)C1C |
| InChI | InChI=1S/C8H17N/c1-6-5-9(4)8(3)7(6)2/h6-8H,5H2,1-4H3 |
| InChIKey | JJPMREHOZHHZSH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,3,4-tetramethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetramethylpyrrolidine?
The IUPAC name of 1,2,3,4-tetramethylpyrrolidine (CID 18735418) is 1,2,3,4-tetramethylpyrrolidine.
What is the SMILES notation for 1,2,3,4-tetramethylpyrrolidine?
The canonical SMILES for 1,2,3,4-tetramethylpyrrolidine is CC1CN(C)C(C)C1C.
What is the InChIKey of 1,2,3,4-tetramethylpyrrolidine?
The InChIKey is JJPMREHOZHHZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-6-5-9(4)8(3)7(6)2/h6-8H,5H2,1-4H3.
What are the key properties of 1,2,3,4-tetramethylpyrrolidine?
1,2,3,4-tetramethylpyrrolidine has a molecular weight of 127.23 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetramethylpyrrolidine is sourced from PubChem (CID 18735418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).