About 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea
1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea (PubChem CID 18735423) has the molecular formula C14H30N2O
and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea |
| PubChem CID | 18735423 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea |
| SMILES | CCCN(CCC(C)(C)C)C(=O)N(CC)CC |
| InChI | InChI=1S/C14H30N2O/c1-7-11-16(12-10-14(4,5)6)13(17)15(8-2)9-3/h7-12H2,1-6H3 |
| InChIKey | XUSOZTVFVKJVEH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea?
The IUPAC name of 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea (CID 18735423) is 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea.
What is the SMILES notation for 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea?
The canonical SMILES for 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea is CCCN(CCC(C)(C)C)C(=O)N(CC)CC.
What is the InChIKey of 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea?
The InChIKey is XUSOZTVFVKJVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O/c1-7-11-16(12-10-14(4,5)6)13(17)15(8-2)9-3/h7-12H2,1-6H3.
What are the key properties of 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea?
1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea has a molecular weight of 242.41 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutyl)-3,3-diethyl-1-propylurea is sourced from PubChem (CID 18735423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).