About 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea
1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea (PubChem CID 18735439) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea.
Molecular Properties
| Compound Name | 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea |
| PubChem CID | 18735439 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea |
| SMILES | CCCCN(CCC(C)(C)C)C(=O)N(CC)CC |
| InChI | InChI=1S/C15H32N2O/c1-7-10-12-17(13-11-15(4,5)6)14(18)16(8-2)9-3/h7-13H2,1-6H3 |
| InChIKey | IBQCXKXQLXXNQQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea?
The IUPAC name of 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea (CID 18735439) is 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea.
What is the SMILES notation for 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea?
The canonical SMILES for 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea is CCCCN(CCC(C)(C)C)C(=O)N(CC)CC.
What is the InChIKey of 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea?
The InChIKey is IBQCXKXQLXXNQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O/c1-7-10-12-17(13-11-15(4,5)6)14(18)16(8-2)9-3/h7-13H2,1-6H3.
What are the key properties of 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea?
1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea has a molecular weight of 256.43 g/mol, XLogP of 3.99, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-(3,3-dimethylbutyl)-3,3-diethylurea is sourced from PubChem (CID 18735439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).